C12H10N4OS — CID 61393369
5-amino-N-(1H-pyrazol-5-yl)-1-benzothiophene-2-carboxamide (PubChem CID 61393369) has the molecular formula C12H10N4OS and a molecular weight of 258.31 g/mol. Its IUPAC name is 5-amino-N-(1H-pyrazol-5-yl)-1-benzothiophene-2-carboxamide.
| Compound Name | 5-amino-N-(1H-pyrazol-5-yl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 61393369 |
| Molecular Formula | C12H10N4OS |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | 5-amino-N-(1H-pyrazol-5-yl)-1-benzothiophene-2-carboxamide |
| SMILES | Nc1ccc2sc(C(=O)Nc3ccn[nH]3)cc2c1 |
| InChI | InChI=1S/C12H10N4OS/c13-8-1-2-9-7(5-8)6-10(18-9)12(17)15-11-3-4-14-16-11/h1-6H,13H2,(H2,14,15,16,17) |
| InChIKey | ICBHRHQVYMHQFQ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|