C13H17ClN2 — CID 61413201
3-[(3-chlorophenyl)methyl-methylamino]pentanenitrile (PubChem CID 61413201) has the molecular formula C13H17ClN2 and a molecular weight of 236.75 g/mol. Its IUPAC name is 3-[(3-chlorophenyl)methyl-methylamino]pentanenitrile.
| Compound Name | 3-[(3-chlorophenyl)methyl-methylamino]pentanenitrile |
|---|---|
| PubChem CID | 61413201 |
| Molecular Formula | C13H17ClN2 |
| Molecular Weight | 236.75 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | 3-[(3-chlorophenyl)methyl-methylamino]pentanenitrile |
| SMILES | CCC(CC#N)N(C)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C13H17ClN2/c1-3-13(7-8-15)16(2)10-11-5-4-6-12(14)9-11/h4-6,9,13H,3,7,10H2,1-2H3 |
| InChIKey | CQZRUKPTCIFAEO-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.75 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |