C12H10BrN3O3 — CID 61413769
N-[(2-bromophenyl)methyl]-2,4-dioxo-1H-pyrimidine-6-carboxamide (PubChem CID 61413769) has the molecular formula C12H10BrN3O3 and a molecular weight of 324.13 g/mol. Its IUPAC name is N-[(2-bromophenyl)methyl]-2,4-dioxo-1H-pyrimidine-6-carboxamide.
| Compound Name | N-[(2-bromophenyl)methyl]-2,4-dioxo-1H-pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 61413769 |
| Molecular Formula | C12H10BrN3O3 |
| Molecular Weight | 324.13 g/mol |
| Exact Mass | 322.99 |
| IUPAC Name | N-[(2-bromophenyl)methyl]-2,4-dioxo-1H-pyrimidine-6-carboxamide |
| SMILES | O=C(NCc1ccccc1Br)c1cc(=O)[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C12H10BrN3O3/c13-8-4-2-1-3-7(8)6-14-11(18)9-5-10(17)16-12(19)15-9/h1-5H,6H2,(H,14,18)(H2,15,16,17,19) |
| InChIKey | NSOUMUIYTOKGPE-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.13 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |