C9H8BrN3S — CID 61414100
4-[(2-bromophenyl)methyl]-1H-1,2,4-triazole-5-thione (PubChem CID 61414100) has the molecular formula C9H8BrN3S and a molecular weight of 270.16 g/mol. Its IUPAC name is 4-[(2-bromophenyl)methyl]-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(2-bromophenyl)methyl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 61414100 |
| Molecular Formula | C9H8BrN3S |
| Molecular Weight | 270.16 g/mol |
| Exact Mass | 268.96 |
| IUPAC Name | 4-[(2-bromophenyl)methyl]-1H-1,2,4-triazole-5-thione |
| SMILES | S=c1[nH]ncn1Cc1ccccc1Br |
| InChI | InChI=1S/C9H8BrN3S/c10-8-4-2-1-3-7(8)5-13-6-11-12-9(13)14/h1-4,6H,5H2,(H,12,14) |
| InChIKey | LCLPSYIHKRTNEZ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.16 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|