C6H11N3S — CID 23459203
4-(2-methylpropyl)-1H-1,2,4-triazole-5-thione (PubChem CID 23459203) has the molecular formula C6H11N3S and a molecular weight of 157.24 g/mol. Its IUPAC name is 4-(2-methylpropyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-(2-methylpropyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 23459203 |
| Molecular Formula | C6H11N3S |
| Molecular Weight | 157.24 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | 4-(2-methylpropyl)-1H-1,2,4-triazole-5-thione |
| SMILES | CC(C)Cn1cn[nH]c1=S |
| InChI | InChI=1S/C6H11N3S/c1-5(2)3-9-4-7-8-6(9)10/h4-5H,3H2,1-2H3,(H,8,10) |
| InChIKey | VHZYWMDGYAAHTG-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.24 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|