C5H6N4S — CID 45088377
3-(5-sulfanylidene-1H-1,2,4-triazol-4-yl)propanenitrile (PubChem CID 45088377) has the molecular formula C5H6N4S and a molecular weight of 154.20 g/mol. Its IUPAC name is 3-(5-sulfanylidene-1H-1,2,4-triazol-4-yl)propanenitrile.
| Compound Name | 3-(5-sulfanylidene-1H-1,2,4-triazol-4-yl)propanenitrile |
|---|---|
| PubChem CID | 45088377 |
| Molecular Formula | C5H6N4S |
| Molecular Weight | 154.20 g/mol |
| Exact Mass | 154.03 |
| IUPAC Name | 3-(5-sulfanylidene-1H-1,2,4-triazol-4-yl)propanenitrile |
| SMILES | N#CCCn1cn[nH]c1=S |
| InChI | InChI=1S/C5H6N4S/c6-2-1-3-9-4-7-8-5(9)10/h4H,1,3H2,(H,8,10) |
| InChIKey | JWBQBOJPEUPSBH-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 57.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.20 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|