C6H10ClN3S — CID 23459241
4-(4-chlorobutyl)-1H-1,2,4-triazole-5-thione (PubChem CID 23459241) has the molecular formula C6H10ClN3S and a molecular weight of 191.69 g/mol. Its IUPAC name is 4-(4-chlorobutyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-(4-chlorobutyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 23459241 |
| Molecular Formula | C6H10ClN3S |
| Molecular Weight | 191.69 g/mol |
| Exact Mass | 191.03 |
| IUPAC Name | 4-(4-chlorobutyl)-1H-1,2,4-triazole-5-thione |
| SMILES | S=c1[nH]ncn1CCCCCl |
| InChI | InChI=1S/C6H10ClN3S/c7-3-1-2-4-10-5-8-9-6(10)11/h5H,1-4H2,(H,9,11) |
| InChIKey | BGQJJVXIAUFVHO-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.69 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|