C10H12N4O2S2 — CID 54995917
4-[2-(5-sulfanylidene-1H-1,2,4-triazol-4-yl)ethyl]benzenesulfonamide (PubChem CID 54995917) has the molecular formula C10H12N4O2S2 and a molecular weight of 284.37 g/mol. Its IUPAC name is 4-[2-(5-sulfanylidene-1H-1,2,4-triazol-4-yl)ethyl]benzenesulfonamide.
| Compound Name | 4-[2-(5-sulfanylidene-1H-1,2,4-triazol-4-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 54995917 |
| Molecular Formula | C10H12N4O2S2 |
| Molecular Weight | 284.37 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | 4-[2-(5-sulfanylidene-1H-1,2,4-triazol-4-yl)ethyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(CCn2cn[nH]c2=S)cc1 |
| InChI | InChI=1S/C10H12N4O2S2/c11-18(15,16)9-3-1-8(2-4-9)5-6-14-7-12-13-10(14)17/h1-4,7H,5-6H2,(H,13,17)(H2,11,15,16) |
| InChIKey | NKOSAFUBVFPQPN-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 93.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.37 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|