C7H13N5OS — CID 83113808
1,1-dimethyl-3-[2-(5-sulfanylidene-1H-1,2,4-triazol-4-yl)ethyl]urea (PubChem CID 83113808) has the molecular formula C7H13N5OS and a molecular weight of 215.28 g/mol. Its IUPAC name is 1,1-dimethyl-3-[2-(5-sulfanylidene-1H-1,2,4-triazol-4-yl)ethyl]urea.
| Compound Name | 1,1-dimethyl-3-[2-(5-sulfanylidene-1H-1,2,4-triazol-4-yl)ethyl]urea |
|---|---|
| PubChem CID | 83113808 |
| Molecular Formula | C7H13N5OS |
| Molecular Weight | 215.28 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | 1,1-dimethyl-3-[2-(5-sulfanylidene-1H-1,2,4-triazol-4-yl)ethyl]urea |
| SMILES | CN(C)C(=O)NCCn1cn[nH]c1=S |
| InChI | InChI=1S/C7H13N5OS/c1-11(2)6(13)8-3-4-12-5-9-10-7(12)14/h5H,3-4H2,1-2H3,(H,8,13)(H,10,14) |
| InChIKey | BUBPNAJVHVPRMR-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 65.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.28 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|