C11H13N3OS — CID 62380786
4-(3-phenoxypropyl)-1H-1,2,4-triazole-5-thione (PubChem CID 62380786) has the molecular formula C11H13N3OS and a molecular weight of 235.31 g/mol. Its IUPAC name is 4-(3-phenoxypropyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-(3-phenoxypropyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 62380786 |
| Molecular Formula | C11H13N3OS |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 4-(3-phenoxypropyl)-1H-1,2,4-triazole-5-thione |
| SMILES | S=c1[nH]ncn1CCCOc1ccccc1 |
| InChI | InChI=1S/C11H13N3OS/c16-11-13-12-9-14(11)7-4-8-15-10-5-2-1-3-6-10/h1-3,5-6,9H,4,7-8H2,(H,13,16) |
| InChIKey | DFPDNIJGOYWEAS-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 42.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|