C14H17BrClN3 — CID 61416100
N-[(2-bromophenyl)methyl]-4-(chloromethyl)-N,1,3-trimethylpyrazol-5-amine (PubChem CID 61416100) has the molecular formula C14H17BrClN3 and a molecular weight of 342.67 g/mol. Its IUPAC name is N-[(2-bromophenyl)methyl]-4-(chloromethyl)-N,1,3-trimethylpyrazol-5-amine.
| Compound Name | N-[(2-bromophenyl)methyl]-4-(chloromethyl)-N,1,3-trimethylpyrazol-5-amine |
|---|---|
| PubChem CID | 61416100 |
| Molecular Formula | C14H17BrClN3 |
| Molecular Weight | 342.67 g/mol |
| Exact Mass | 341.03 |
| IUPAC Name | N-[(2-bromophenyl)methyl]-4-(chloromethyl)-N,1,3-trimethylpyrazol-5-amine |
| SMILES | Cc1nn(C)c(N(C)Cc2ccccc2Br)c1CCl |
| InChI | InChI=1S/C14H17BrClN3/c1-10-12(8-16)14(19(3)17-10)18(2)9-11-6-4-5-7-13(11)15/h4-7H,8-9H2,1-3H3 |
| InChIKey | ZWGRWVOSIPXWRI-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.67 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|