C12H18ClN5 — CID 63013984
4-(chloromethyl)-N,1,3-trimethyl-N-[(1-methylimidazol-2-yl)methyl]pyrazol-5-amine (PubChem CID 63013984) has the molecular formula C12H18ClN5 and a molecular weight of 267.76 g/mol. Its IUPAC name is 4-(chloromethyl)-N,1,3-trimethyl-N-[(1-methylimidazol-2-yl)methyl]pyrazol-5-amine.
| Compound Name | 4-(chloromethyl)-N,1,3-trimethyl-N-[(1-methylimidazol-2-yl)methyl]pyrazol-5-amine |
|---|---|
| PubChem CID | 63013984 |
| Molecular Formula | C12H18ClN5 |
| Molecular Weight | 267.76 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | 4-(chloromethyl)-N,1,3-trimethyl-N-[(1-methylimidazol-2-yl)methyl]pyrazol-5-amine |
| SMILES | Cc1nn(C)c(N(C)Cc2nccn2C)c1CCl |
| InChI | InChI=1S/C12H18ClN5/c1-9-10(7-13)12(18(4)15-9)17(3)8-11-14-5-6-16(11)2/h5-6H,7-8H2,1-4H3 |
| InChIKey | JACKIWHDHSKTBI-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 38.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.76 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|