C11H15ClN4S — CID 55011827
4-(chloromethyl)-N,1,3-trimethyl-N-(1,3-thiazol-4-ylmethyl)pyrazol-5-amine (PubChem CID 55011827) has the molecular formula C11H15ClN4S and a molecular weight of 270.79 g/mol. Its IUPAC name is 4-(chloromethyl)-N,1,3-trimethyl-N-(1,3-thiazol-4-ylmethyl)pyrazol-5-amine.
| Compound Name | 4-(chloromethyl)-N,1,3-trimethyl-N-(1,3-thiazol-4-ylmethyl)pyrazol-5-amine |
|---|---|
| PubChem CID | 55011827 |
| Molecular Formula | C11H15ClN4S |
| Molecular Weight | 270.79 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 4-(chloromethyl)-N,1,3-trimethyl-N-(1,3-thiazol-4-ylmethyl)pyrazol-5-amine |
| SMILES | Cc1nn(C)c(N(C)Cc2cscn2)c1CCl |
| InChI | InChI=1S/C11H15ClN4S/c1-8-10(4-12)11(16(3)14-8)15(2)5-9-6-17-7-13-9/h6-7H,4-5H2,1-3H3 |
| InChIKey | LBRHCAHDAVMLIO-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.79 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|