C14H18IN3O2 — CID 61417653
N-[(4-methoxyphenyl)methyl]-N,3-dimethylimidazol-3-ium-1-carboxamide iodide (PubChem CID 61417653) has the molecular formula C14H18IN3O2 and a molecular weight of 387.22 g/mol. Its IUPAC name is N-[(4-methoxyphenyl)methyl]-N,3-dimethylimidazol-3-ium-1-carboxamide iodide.
| Compound Name | N-[(4-methoxyphenyl)methyl]-N,3-dimethylimidazol-3-ium-1-carboxamide iodide |
|---|---|
| PubChem CID | 61417653 |
| Molecular Formula | C14H18IN3O2 |
| Molecular Weight | 387.22 g/mol |
| Exact Mass | 387.04 |
| IUPAC Name | N-[(4-methoxyphenyl)methyl]-N,3-dimethylimidazol-3-ium-1-carboxamide iodide |
| SMILES | COc1ccc(CN(C)C(=O)n2cc[n+](C)c2)cc1.[I-] |
| InChI | InChI=1S/C14H18N3O2.HI/c1-15-8-9-17(11-15)14(18)16(2)10-12-4-6-13(19-3)7-5-12;/h4-9,11H,10H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | KHMPVDWHIDFZFL-UHFFFAOYSA-M |
| XLogP | -1.57 |
| TPSA | 38.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.22 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|