C20H17N4O3+ — CID 155280782
N-benzyl-N-(1,3-dioxoisoindol-2-yl)-3-methylimidazol-3-ium-1-carboxamide (PubChem CID 155280782) has the molecular formula C20H17N4O3+ and a molecular weight of 361.38 g/mol. Its IUPAC name is N-benzyl-N-(1,3-dioxoisoindol-2-yl)-3-methylimidazol-3-ium-1-carboxamide.
| Compound Name | N-benzyl-N-(1,3-dioxoisoindol-2-yl)-3-methylimidazol-3-ium-1-carboxamide |
|---|---|
| PubChem CID | 155280782 |
| Molecular Formula | C20H17N4O3+ |
| Molecular Weight | 361.38 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | N-benzyl-N-(1,3-dioxoisoindol-2-yl)-3-methylimidazol-3-ium-1-carboxamide |
| SMILES | C[n+]1ccn(C(=O)N(Cc2ccccc2)N2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C20H17N4O3/c1-21-11-12-22(14-21)20(27)23(13-15-7-3-2-4-8-15)24-18(25)16-9-5-6-10-17(16)19(24)26/h2-12,14H,13H2,1H3/q+1 |
| InChIKey | HOLYCNUCSKZXJO-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 66.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.38 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|