C11H24N2OS — CID 61419499
1-(propan-2-ylamino)-3-(1,4-thiazepan-4-yl)propan-2-ol (PubChem CID 61419499) has the molecular formula C11H24N2OS and a molecular weight of 232.39 g/mol. Its IUPAC name is 1-(propan-2-ylamino)-3-(1,4-thiazepan-4-yl)propan-2-ol.
| Compound Name | 1-(propan-2-ylamino)-3-(1,4-thiazepan-4-yl)propan-2-ol |
|---|---|
| PubChem CID | 61419499 |
| Molecular Formula | C11H24N2OS |
| Molecular Weight | 232.39 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | 1-(propan-2-ylamino)-3-(1,4-thiazepan-4-yl)propan-2-ol |
| SMILES | CC(C)NCC(O)CN1CCCSCC1 |
| InChI | InChI=1S/C11H24N2OS/c1-10(2)12-8-11(14)9-13-4-3-6-15-7-5-13/h10-12,14H,3-9H2,1-2H3 |
| InChIKey | ZMPIAJHCGQBFPK-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.39 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |