C8H16BrNOS — CID 112561351
1-bromo-3-(1,4-thiazepan-4-yl)propan-2-ol (PubChem CID 112561351) has the molecular formula C8H16BrNOS and a molecular weight of 254.19 g/mol. Its IUPAC name is 1-bromo-3-(1,4-thiazepan-4-yl)propan-2-ol.
| Compound Name | 1-bromo-3-(1,4-thiazepan-4-yl)propan-2-ol |
|---|---|
| PubChem CID | 112561351 |
| Molecular Formula | C8H16BrNOS |
| Molecular Weight | 254.19 g/mol |
| Exact Mass | 253.01 |
| IUPAC Name | 1-bromo-3-(1,4-thiazepan-4-yl)propan-2-ol |
| SMILES | OC(CBr)CN1CCCSCC1 |
| InChI | InChI=1S/C8H16BrNOS/c9-6-8(11)7-10-2-1-4-12-5-3-10/h8,11H,1-7H2 |
| InChIKey | FXMKLEBBRCPMKG-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.19 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|