4-ethylpiperidine-1-sulfonyl chloride

C7H14ClNO2S — CID 61420702

IUPAC4-ethylpiperidine-1-sulfonyl chloride
SMILESCCC1CCN(S(=O)(=O)Cl)CC1
InChIInChI=1S/C7H14ClNO2S/c1-2-7-3-5-9(6-4-7)12(8,10)11/h7H,2-6H2,1H3
InChIKeyZFBJGVKLVYWVDB-UHFFFAOYSA-N
MW211.71 g/mol
LogP1.59
Rot. Bonds2

About 4-ethylpiperidine-1-sulfonyl chloride

4-ethylpiperidine-1-sulfonyl chloride (PubChem CID 61420702) has the molecular formula C7H14ClNO2S and a molecular weight of 211.71 g/mol. Its IUPAC name is 4-ethylpiperidine-1-sulfonyl chloride.

Molecular Properties

Compound Name4-ethylpiperidine-1-sulfonyl chloride
PubChem CID61420702
Molecular FormulaC7H14ClNO2S
Molecular Weight211.71 g/mol
Exact Mass211.04
IUPAC Name4-ethylpiperidine-1-sulfonyl chloride
SMILESCCC1CCN(S(=O)(=O)Cl)CC1
InChIInChI=1S/C7H14ClNO2S/c1-2-7-3-5-9(6-4-7)12(8,10)11/h7H,2-6H2,1H3
InChIKeyZFBJGVKLVYWVDB-UHFFFAOYSA-N
XLogP1.59
TPSA37.38 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500211.71
LogP ≤ 51.59
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze 4-ethylpiperidine-1-sulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

Piperidine-1-sulfonyl chloride
CID 11298344
3,5-Dimethylpiperidine-1-sulfonyl chloride
CID 16228529
3-Methylpiperidine-1-sulfonyl chloride
CID 16769272
4,4-Dimethylpiperidine-1-sulfonyl chloride
CID 56828646
4-(Trifluoromethyl)piperidine-1-sulfonyl chloride
CID 65535206
4-Cyano-1-piperidinesulfonyl chloride
CID 72208308
N,N,4-trimethylpiperidine-1-sulfonamide
CID 224932
4-Methylpiperidine-1-sulfonyl chloride
CID 16228446
3-Fluoro-4-methylpiperidine-1-sulfonamide
CID 129075058
1-Methanesulfonyl-4-methylpiperidine
CID 706832
4-Methylpiperidine-1-sulfonyl fluoride
CID 56965516
4-(Difluoromethyl)piperidine-1-sulfonyl chloride
CID 130680977

Frequently Asked Questions

What is the IUPAC name of 4-ethylpiperidine-1-sulfonyl chloride?
The IUPAC name of 4-ethylpiperidine-1-sulfonyl chloride (CID 61420702) is 4-ethylpiperidine-1-sulfonyl chloride.
What is the SMILES notation for 4-ethylpiperidine-1-sulfonyl chloride?
The canonical SMILES for 4-ethylpiperidine-1-sulfonyl chloride is CCC1CCN(S(=O)(=O)Cl)CC1.
What is the InChIKey of 4-ethylpiperidine-1-sulfonyl chloride?
The InChIKey is ZFBJGVKLVYWVDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14ClNO2S/c1-2-7-3-5-9(6-4-7)12(8,10)11/h7H,2-6H2,1H3.
What are the key properties of 4-ethylpiperidine-1-sulfonyl chloride?
4-ethylpiperidine-1-sulfonyl chloride has a molecular weight of 211.71 g/mol, XLogP of 1.59, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethylpiperidine-1-sulfonyl chloride is sourced from PubChem (CID 61420702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).