C15H16FNO2S — CID 61423333
[2-fluoro-4-(3-hydroxyprop-1-ynyl)phenyl]-(1,4-thiazepan-4-yl)methanone (PubChem CID 61423333) has the molecular formula C15H16FNO2S and a molecular weight of 293.36 g/mol. Its IUPAC name is [2-fluoro-4-(3-hydroxyprop-1-ynyl)phenyl]-(1,4-thiazepan-4-yl)methanone.
| Compound Name | [2-fluoro-4-(3-hydroxyprop-1-ynyl)phenyl]-(1,4-thiazepan-4-yl)methanone |
|---|---|
| PubChem CID | 61423333 |
| Molecular Formula | C15H16FNO2S |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | [2-fluoro-4-(3-hydroxyprop-1-ynyl)phenyl]-(1,4-thiazepan-4-yl)methanone |
| SMILES | O=C(c1ccc(C#CCO)cc1F)N1CCCSCC1 |
| InChI | InChI=1S/C15H16FNO2S/c16-14-11-12(3-1-8-18)4-5-13(14)15(19)17-6-2-9-20-10-7-17/h4-5,11,18H,2,6-10H2 |
| InChIKey | YNAGTPYACWLUIY-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|