C16H23N3O2 — CID 61441471
1-(1,3-benzodioxol-5-yl)-2-(4-cyclopropylpiperazin-1-yl)ethanamine (PubChem CID 61441471) has the molecular formula C16H23N3O2 and a molecular weight of 289.38 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-2-(4-cyclopropylpiperazin-1-yl)ethanamine.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-2-(4-cyclopropylpiperazin-1-yl)ethanamine |
|---|---|
| PubChem CID | 61441471 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-2-(4-cyclopropylpiperazin-1-yl)ethanamine |
| SMILES | NC(CN1CCN(C2CC2)CC1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H23N3O2/c17-14(12-1-4-15-16(9-12)21-11-20-15)10-18-5-7-19(8-6-18)13-2-3-13/h1,4,9,13-14H,2-3,5-8,10-11,17H2 |
| InChIKey | MULGDXHSKATFJR-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 50.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |