C11H12N4O2 — CID 16788265
1-(1,3-benzodioxol-5-yl)-2-(1,2,4-triazol-1-yl)ethanamine (PubChem CID 16788265) has the molecular formula C11H12N4O2 and a molecular weight of 232.24 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-2-(1,2,4-triazol-1-yl)ethanamine.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-2-(1,2,4-triazol-1-yl)ethanamine |
|---|---|
| PubChem CID | 16788265 |
| Molecular Formula | C11H12N4O2 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-2-(1,2,4-triazol-1-yl)ethanamine |
| SMILES | NC(Cn1cncn1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C11H12N4O2/c12-9(4-15-6-13-5-14-15)8-1-2-10-11(3-8)17-7-16-10/h1-3,5-6,9H,4,7,12H2 |
| InChIKey | BSZFZTJADZMHQJ-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |