N-ethyl-N-(2-methoxyethyl)sulfamoyl chloride

C5H12ClNO3S — CID 61448499

IUPACN-ethyl-N-(2-methoxyethyl)sulfamoyl chloride
SMILESCCN(CCOC)S(=O)(=O)Cl
InChIInChI=1S/C5H12ClNO3S/c1-3-7(4-5-10-2)11(6,8)9/h3-5H2,1-2H3
InChIKeyHWRJIZQJGGLQKY-UHFFFAOYSA-N
MW201.67 g/mol
LogP0.44
Rot. Bonds5

About N-ethyl-N-(2-methoxyethyl)sulfamoyl chloride

N-ethyl-N-(2-methoxyethyl)sulfamoyl chloride (PubChem CID 61448499) has the molecular formula C5H12ClNO3S and a molecular weight of 201.67 g/mol. Its IUPAC name is N-ethyl-N-(2-methoxyethyl)sulfamoyl chloride.

Molecular Properties

Compound NameN-ethyl-N-(2-methoxyethyl)sulfamoyl chloride
PubChem CID61448499
Molecular FormulaC5H12ClNO3S
Molecular Weight201.67 g/mol
Exact Mass201.02
IUPAC NameN-ethyl-N-(2-methoxyethyl)sulfamoyl chloride
SMILESCCN(CCOC)S(=O)(=O)Cl
InChIInChI=1S/C5H12ClNO3S/c1-3-7(4-5-10-2)11(6,8)9/h3-5H2,1-2H3
InChIKeyHWRJIZQJGGLQKY-UHFFFAOYSA-N
XLogP0.44
TPSA46.61 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500201.67
LogP ≤ 50.44
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze N-ethyl-N-(2-methoxyethyl)sulfamoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

Morpholine-4-sulfonyl chloride
CID 12798265
N,N-bis(2-methoxyethyl)sulfamoyl chloride
CID 16228513
N-(2-methoxyethyl)-N-methylsulfamoyl chloride
CID 54592729
((2-Methoxyethyl)(methyl)sulfamoyl)amine
CID 61067625
N,N-bis(2-methoxyethyl)sulfamoyl fluoride
CID 162350170
N-ethyl-N-(2-methoxyethyl)sulfamoyl fluoride
CID 162734504
N-(2-methoxyethyl)-N-methylsulfamoyl fluoride
CID 175702015
N-(2-methoxyethyl)-N-propylsulfamoyl fluoride
CID 166456350
N-(1-methoxyethyl)-N-methylsulfamoyl chloride
CID 21113541
N,N-bis(2-methoxyethyl)thiohydroxylamine
CID 21919465
1-[Ethyl(sulfinato)amino]-2-methoxyethane
CID 53816941
1-[Ethyl(methoxysulfinyl)amino]-2-methoxyethane
CID 54237479

Frequently Asked Questions

What is the IUPAC name of N-ethyl-N-(2-methoxyethyl)sulfamoyl chloride?
The IUPAC name of N-ethyl-N-(2-methoxyethyl)sulfamoyl chloride (CID 61448499) is N-ethyl-N-(2-methoxyethyl)sulfamoyl chloride.
What is the SMILES notation for N-ethyl-N-(2-methoxyethyl)sulfamoyl chloride?
The canonical SMILES for N-ethyl-N-(2-methoxyethyl)sulfamoyl chloride is CCN(CCOC)S(=O)(=O)Cl.
What is the InChIKey of N-ethyl-N-(2-methoxyethyl)sulfamoyl chloride?
The InChIKey is HWRJIZQJGGLQKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12ClNO3S/c1-3-7(4-5-10-2)11(6,8)9/h3-5H2,1-2H3.
What are the key properties of N-ethyl-N-(2-methoxyethyl)sulfamoyl chloride?
N-ethyl-N-(2-methoxyethyl)sulfamoyl chloride has a molecular weight of 201.67 g/mol, XLogP of 0.44, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N-(2-methoxyethyl)sulfamoyl chloride is sourced from PubChem (CID 61448499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).