C17H18N2O5S — CID 6145286
(4Z)-4-[[2-(4-methoxyphenoxy)acetyl]hydrazinylidene]-4-thiophen-2-ylbutanoic acid (PubChem CID 6145286) has the molecular formula C17H18N2O5S and a molecular weight of 362.41 g/mol. Its IUPAC name is (4Z)-4-[[2-(4-methoxyphenoxy)acetyl]hydrazinylidene]-4-thiophen-2-ylbutanoic acid.
| Compound Name | (4Z)-4-[[2-(4-methoxyphenoxy)acetyl]hydrazinylidene]-4-thiophen-2-ylbutanoic acid |
|---|---|
| PubChem CID | 6145286 |
| Molecular Formula | C17H18N2O5S |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | (4Z)-4-[[2-(4-methoxyphenoxy)acetyl]hydrazinylidene]-4-thiophen-2-ylbutanoic acid |
| SMILES | COc1ccc(OCC(=O)N/N=C(/CCC(=O)O)c2cccs2)cc1 |
| InChI | InChI=1S/C17H18N2O5S/c1-23-12-4-6-13(7-5-12)24-11-16(20)19-18-14(8-9-17(21)22)15-3-2-10-25-15/h2-7,10H,8-9,11H2,1H3,(H,19,20)(H,21,22)/b18-14- |
| InChIKey | MQVVRKGQFCHGHE-JXAWBTAJSA-N |
| XLogP | 2.52 |
| TPSA | 97.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|