C17H18N2O5S — CID 2422668
(E)-4-[2-[2-(4-methoxyphenoxy)acetyl]hydrazinyl]-4-thiophen-2-ylbut-3-enoic acid (PubChem CID 2422668) has the molecular formula C17H18N2O5S and a molecular weight of 362.41 g/mol. Its IUPAC name is (E)-4-[2-[2-(4-methoxyphenoxy)acetyl]hydrazinyl]-4-thiophen-2-ylbut-3-enoic acid.
| Compound Name | (E)-4-[2-[2-(4-methoxyphenoxy)acetyl]hydrazinyl]-4-thiophen-2-ylbut-3-enoic acid |
|---|---|
| PubChem CID | 2422668 |
| Molecular Formula | C17H18N2O5S |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | (E)-4-[2-[2-(4-methoxyphenoxy)acetyl]hydrazinyl]-4-thiophen-2-ylbut-3-enoic acid |
| SMILES | COc1ccc(OCC(=O)NN/C(=C/CC(=O)O)c2cccs2)cc1 |
| InChI | InChI=1S/C17H18N2O5S/c1-23-12-4-6-13(7-5-12)24-11-16(20)19-18-14(8-9-17(21)22)15-3-2-10-25-15/h2-8,10,18H,9,11H2,1H3,(H,19,20)(H,21,22)/b14-8+ |
| InChIKey | QCVOIGKPLVTUJH-RIYZIHGNSA-N |
| XLogP | 2.27 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|