C8H14N4O — CID 61463114
3-(2-pyrazol-1-ylethylamino)propanamide (PubChem CID 61463114) has the molecular formula C8H14N4O and a molecular weight of 182.23 g/mol. Its IUPAC name is 3-(2-pyrazol-1-ylethylamino)propanamide.
| Compound Name | 3-(2-pyrazol-1-ylethylamino)propanamide |
|---|---|
| PubChem CID | 61463114 |
| Molecular Formula | C8H14N4O |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.12 |
| IUPAC Name | 3-(2-pyrazol-1-ylethylamino)propanamide |
| SMILES | NC(=O)CCNCCn1cccn1 |
| InChI | InChI=1S/C8H14N4O/c9-8(13)2-4-10-5-7-12-6-1-3-11-12/h1,3,6,10H,2,4-5,7H2,(H2,9,13) |
| InChIKey | HSEXIZLXGQIEPX-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|