C14H20Cl2N2O2S — CID 61466502
4-amino-2,6-dichloro-N-(2-ethylcyclohexyl)benzenesulfonamide (PubChem CID 61466502) has the molecular formula C14H20Cl2N2O2S and a molecular weight of 351.30 g/mol. Its IUPAC name is 4-amino-2,6-dichloro-N-(2-ethylcyclohexyl)benzenesulfonamide.
| Compound Name | 4-amino-2,6-dichloro-N-(2-ethylcyclohexyl)benzenesulfonamide |
|---|---|
| PubChem CID | 61466502 |
| Molecular Formula | C14H20Cl2N2O2S |
| Molecular Weight | 351.30 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | 4-amino-2,6-dichloro-N-(2-ethylcyclohexyl)benzenesulfonamide |
| SMILES | CCC1CCCCC1NS(=O)(=O)c1c(Cl)cc(N)cc1Cl |
| InChI | InChI=1S/C14H20Cl2N2O2S/c1-2-9-5-3-4-6-13(9)18-21(19,20)14-11(15)7-10(17)8-12(14)16/h7-9,13,18H,2-6,17H2,1H3 |
| InChIKey | JPQBFPQHGMOYRR-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.30 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|