C12H22N2S — CID 61469915
N-(4-ethylcyclohexyl)-5,6-dihydro-4H-1,3-thiazin-2-amine (PubChem CID 61469915) has the molecular formula C12H22N2S and a molecular weight of 226.39 g/mol. Its IUPAC name is N-(4-ethylcyclohexyl)-5,6-dihydro-4H-1,3-thiazin-2-amine.
| Compound Name | N-(4-ethylcyclohexyl)-5,6-dihydro-4H-1,3-thiazin-2-amine |
|---|---|
| PubChem CID | 61469915 |
| Molecular Formula | C12H22N2S |
| Molecular Weight | 226.39 g/mol |
| Exact Mass | 226.15 |
| IUPAC Name | N-(4-ethylcyclohexyl)-5,6-dihydro-4H-1,3-thiazin-2-amine |
| SMILES | CCC1CCC(NC2=NCCCS2)CC1 |
| InChI | InChI=1S/C12H22N2S/c1-2-10-4-6-11(7-5-10)14-12-13-8-3-9-15-12/h10-11H,2-9H2,1H3,(H,13,14) |
| InChIKey | SZASMCZWWHGGKF-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.39 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |