C8H15N3S — CID 115016981
N-piperidin-4-yl-4,5-dihydro-1,3-thiazol-2-amine (PubChem CID 115016981) has the molecular formula C8H15N3S and a molecular weight of 185.30 g/mol. Its IUPAC name is N-piperidin-4-yl-4,5-dihydro-1,3-thiazol-2-amine.
| Compound Name | N-piperidin-4-yl-4,5-dihydro-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 115016981 |
| Molecular Formula | C8H15N3S |
| Molecular Weight | 185.30 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | N-piperidin-4-yl-4,5-dihydro-1,3-thiazol-2-amine |
| SMILES | C1CSC(NC2CCNCC2)=N1 |
| InChI | InChI=1S/C8H15N3S/c1-3-9-4-2-7(1)11-8-10-5-6-12-8/h7,9H,1-6H2,(H,10,11) |
| InChIKey | BTYLNUMXQLPCRD-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.30 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |