C6H11N5S — CID 117044442
N-piperidin-4-ylthiatriazol-5-amine (PubChem CID 117044442) has the molecular formula C6H11N5S and a molecular weight of 185.26 g/mol. Its IUPAC name is N-piperidin-4-ylthiatriazol-5-amine.
| Compound Name | N-piperidin-4-ylthiatriazol-5-amine |
|---|---|
| PubChem CID | 117044442 |
| Molecular Formula | C6H11N5S |
| Molecular Weight | 185.26 g/mol |
| Exact Mass | 185.07 |
| IUPAC Name | N-piperidin-4-ylthiatriazol-5-amine |
| SMILES | C1CC(Nc2nnns2)CCN1 |
| InChI | InChI=1S/C6H11N5S/c1-3-7-4-2-5(1)8-6-9-10-11-12-6/h5,7H,1-4H2,(H,8,9,11) |
| InChIKey | DDFRJGAUAHOGJA-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.26 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |