C12H22N2O — CID 61470415
1-N-[2-(furan-2-yl)ethyl]-4-methylpentane-1,2-diamine (PubChem CID 61470415) has the molecular formula C12H22N2O and a molecular weight of 210.32 g/mol. Its IUPAC name is 1-N-[2-(furan-2-yl)ethyl]-4-methylpentane-1,2-diamine.
| Compound Name | 1-N-[2-(furan-2-yl)ethyl]-4-methylpentane-1,2-diamine |
|---|---|
| PubChem CID | 61470415 |
| Molecular Formula | C12H22N2O |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.17 |
| IUPAC Name | 1-N-[2-(furan-2-yl)ethyl]-4-methylpentane-1,2-diamine |
| SMILES | CC(C)CC(N)CNCCc1ccco1 |
| InChI | InChI=1S/C12H22N2O/c1-10(2)8-11(13)9-14-6-5-12-4-3-7-15-12/h3-4,7,10-11,14H,5-6,8-9,13H2,1-2H3 |
| InChIKey | FZBBIKPYFMFJNW-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 51.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|