C10H17NO3 — CID 63684806
N-[2-(furan-2-yl)ethyl]-2,2-dimethoxyethanamine (PubChem CID 63684806) has the molecular formula C10H17NO3 and a molecular weight of 199.25 g/mol. Its IUPAC name is N-[2-(furan-2-yl)ethyl]-2,2-dimethoxyethanamine.
| Compound Name | N-[2-(furan-2-yl)ethyl]-2,2-dimethoxyethanamine |
|---|---|
| PubChem CID | 63684806 |
| Molecular Formula | C10H17NO3 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | N-[2-(furan-2-yl)ethyl]-2,2-dimethoxyethanamine |
| SMILES | COC(CNCCc1ccco1)OC |
| InChI | InChI=1S/C10H17NO3/c1-12-10(13-2)8-11-6-5-9-4-3-7-14-9/h3-4,7,10-11H,5-6,8H2,1-2H3 |
| InChIKey | IVGSUQGGCIFJRJ-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 43.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|