C13H24N2O — CID 65266782
1-N-[2-(furan-2-yl)ethyl]-2,2,3-trimethylbutane-1,3-diamine (PubChem CID 65266782) has the molecular formula C13H24N2O and a molecular weight of 224.35 g/mol. Its IUPAC name is 1-N-[2-(furan-2-yl)ethyl]-2,2,3-trimethylbutane-1,3-diamine.
| Compound Name | 1-N-[2-(furan-2-yl)ethyl]-2,2,3-trimethylbutane-1,3-diamine |
|---|---|
| PubChem CID | 65266782 |
| Molecular Formula | C13H24N2O |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.19 |
| IUPAC Name | 1-N-[2-(furan-2-yl)ethyl]-2,2,3-trimethylbutane-1,3-diamine |
| SMILES | CC(C)(N)C(C)(C)CNCCc1ccco1 |
| InChI | InChI=1S/C13H24N2O/c1-12(2,13(3,4)14)10-15-8-7-11-6-5-9-16-11/h5-6,9,15H,7-8,10,14H2,1-4H3 |
| InChIKey | PIXGSYDBTDHHRH-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 51.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|