C13H17N3O4S — CID 61486762
2-[(5-amino-1,3-benzoxazol-2-yl)sulfinyl]-N-(3-methoxypropyl)acetamide (PubChem CID 61486762) has the molecular formula C13H17N3O4S and a molecular weight of 311.36 g/mol. Its IUPAC name is 2-[(5-amino-1,3-benzoxazol-2-yl)sulfinyl]-N-(3-methoxypropyl)acetamide.
| Compound Name | 2-[(5-amino-1,3-benzoxazol-2-yl)sulfinyl]-N-(3-methoxypropyl)acetamide |
|---|---|
| PubChem CID | 61486762 |
| Molecular Formula | C13H17N3O4S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 2-[(5-amino-1,3-benzoxazol-2-yl)sulfinyl]-N-(3-methoxypropyl)acetamide |
| SMILES | COCCCNC(=O)CS(=O)c1nc2cc(N)ccc2o1 |
| InChI | InChI=1S/C13H17N3O4S/c1-19-6-2-5-15-12(17)8-21(18)13-16-10-7-9(14)3-4-11(10)20-13/h3-4,7H,2,5-6,8,14H2,1H3,(H,15,17) |
| InChIKey | PCBSRWDVKZOBDC-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 107.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|