C13H11F4NO3 — CID 61491397
5-fluoro-1-[3-(2,2,2-trifluoroethoxy)propyl]indole-2,3-dione (PubChem CID 61491397) has the molecular formula C13H11F4NO3 and a molecular weight of 305.23 g/mol. Its IUPAC name is 5-fluoro-1-[3-(2,2,2-trifluoroethoxy)propyl]indole-2,3-dione.
| Compound Name | 5-fluoro-1-[3-(2,2,2-trifluoroethoxy)propyl]indole-2,3-dione |
|---|---|
| PubChem CID | 61491397 |
| Molecular Formula | C13H11F4NO3 |
| Molecular Weight | 305.23 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | 5-fluoro-1-[3-(2,2,2-trifluoroethoxy)propyl]indole-2,3-dione |
| SMILES | O=C1C(=O)N(CCCOCC(F)(F)F)c2ccc(F)cc21 |
| InChI | InChI=1S/C13H11F4NO3/c14-8-2-3-10-9(6-8)11(19)12(20)18(10)4-1-5-21-7-13(15,16)17/h2-3,6H,1,4-5,7H2 |
| InChIKey | FXCLOVBMFGRJQG-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.23 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|