C23H20N4O3S2 — CID 6151428
(6Z)-2-benzylsulfanyl-5-imino-6-[(3-methoxy-4-prop-2-enoxyphenyl)methylidene]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one (PubChem CID 6151428) has the molecular formula C23H20N4O3S2 and a molecular weight of 464.57 g/mol. Its IUPAC name is (6Z)-2-benzylsulfanyl-5-imino-6-[(3-methoxy-4-prop-2-enoxyphenyl)methylidene]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | (6Z)-2-benzylsulfanyl-5-imino-6-[(3-methoxy-4-prop-2-enoxyphenyl)methylidene]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 6151428 |
| Molecular Formula | C23H20N4O3S2 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.10 |
| IUPAC Name | (6Z)-2-benzylsulfanyl-5-imino-6-[(3-methoxy-4-prop-2-enoxyphenyl)methylidene]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1C(=C/c2ccc(OCC=C)c(OC)c2)/C(=O)N=C2SC(SCc3ccccc3)=NN2/1 |
| InChI | InChI=1S/C23H20N4O3S2/c1-3-11-30-18-10-9-16(13-19(18)29-2)12-17-20(24)27-22(25-21(17)28)32-23(26-27)31-14-15-7-5-4-6-8-15/h3-10,12-13,24H,1,11,14H2,2H3/b17-12-,24-20- |
| InChIKey | VSTSYDGYIAOLLK-MAWDPOHQSA-N |
| XLogP | 4.77 |
| TPSA | 87.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|