C34H67NO7Si6 — CID 615196
[2,3,4,5,6-pentakis(trimethylsilyloxy)cyclohexyl] 2-(1-trimethylsilylindol-3-yl)acetate (PubChem CID 615196) has the molecular formula C34H67NO7Si6 and a molecular weight of 770.43 g/mol. Its IUPAC name is [2,3,4,5,6-pentakis(trimethylsilyloxy)cyclohexyl] 2-(1-trimethylsilylindol-3-yl)acetate.
| Compound Name | [2,3,4,5,6-pentakis(trimethylsilyloxy)cyclohexyl] 2-(1-trimethylsilylindol-3-yl)acetate |
|---|---|
| PubChem CID | 615196 |
| Molecular Formula | C34H67NO7Si6 |
| Molecular Weight | 770.43 g/mol |
| Exact Mass | 769.35 |
| IUPAC Name | [2,3,4,5,6-pentakis(trimethylsilyloxy)cyclohexyl] 2-(1-trimethylsilylindol-3-yl)acetate |
| SMILES | C[Si](C)(C)OC1C(OC(=O)Cc2cn([Si](C)(C)C)c3ccccc23)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C |
| InChI | InChI=1S/C34H67NO7Si6/c1-43(2,3)35-24-25(26-21-19-20-22-27(26)35)23-28(36)37-29-30(38-44(4,5)6)32(40-46(10,11)12)34(42-48(16,17)18)33(41-47(13,14)15)31(29)39-45(7,8)9/h19-22,24,29-34H,23H2,1-18H3 |
| InChIKey | KYNBULGUPDREMI-UHFFFAOYSA-N |
| XLogP | 8.89 |
| TPSA | 77.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.43 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|