C12H7N7O2 — CID 616643
4-amino-6-imino-1-(2-nitrophenyl)pyridazine-3,5-dicarbonitrile (PubChem CID 616643) has the molecular formula C12H7N7O2 and a molecular weight of 281.24 g/mol. Its IUPAC name is 4-amino-6-imino-1-(2-nitrophenyl)pyridazine-3,5-dicarbonitrile.
| Compound Name | 4-amino-6-imino-1-(2-nitrophenyl)pyridazine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 616643 |
| Molecular Formula | C12H7N7O2 |
| Molecular Weight | 281.24 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | 4-amino-6-imino-1-(2-nitrophenyl)pyridazine-3,5-dicarbonitrile |
| SMILES | [H]/N=c1\c(C#N)c(N)c(C#N)nn1-c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H7N7O2/c13-5-7-11(15)8(6-14)17-18(12(7)16)9-3-1-2-4-10(9)19(20)21/h1-4,16H,15H2/b16-12+ |
| InChIKey | UWHYREHIJVNZRW-FOWTUZBSSA-N |
| XLogP | 0.59 |
| TPSA | 158.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.24 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|