C10H12N4OS — CID 616790
5-methyl-10-thia-1,5,6,8-tetrazatricyclo[7.5.0.03,7]tetradeca-3,6,8-trien-2-one (PubChem CID 616790) has the molecular formula C10H12N4OS and a molecular weight of 236.30 g/mol. Its IUPAC name is 5-methyl-10-thia-1,5,6,8-tetrazatricyclo[7.5.0.03,7]tetradeca-3,6,8-trien-2-one.
| Compound Name | 5-methyl-10-thia-1,5,6,8-tetrazatricyclo[7.5.0.03,7]tetradeca-3,6,8-trien-2-one |
|---|---|
| PubChem CID | 616790 |
| Molecular Formula | C10H12N4OS |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | 5-methyl-10-thia-1,5,6,8-tetrazatricyclo[7.5.0.03,7]tetradeca-3,6,8-trien-2-one |
| SMILES | Cn1cc2c(=O)n3c(nc2n1)SCCCC3 |
| InChI | InChI=1S/C10H12N4OS/c1-13-6-7-8(12-13)11-10-14(9(7)15)4-2-3-5-16-10/h6H,2-5H2,1H3 |
| InChIKey | LCUCJDRCMWRPMR-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 52.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |