About 1-phenylethylhydrazine
1-phenylethylhydrazine (PubChem CID 6179) has the molecular formula C8H12N2
and a molecular weight of 136.20 g/mol. Its IUPAC name is 1-phenylethylhydrazine.
Molecular Properties
| Compound Name | 1-phenylethylhydrazine |
| PubChem CID | 6179 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | 1-phenylethylhydrazine |
| SMILES | CC(NN)c1ccccc1 |
| InChI | InChI=1S/C8H12N2/c1-7(10-9)8-5-3-2-4-6-8/h2-7,10H,9H2,1H3 |
| InChIKey | HHRZAEJMHSGZNP-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-phenylethylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylethylhydrazine?
The IUPAC name of 1-phenylethylhydrazine (CID 6179) is 1-phenylethylhydrazine.
What is the SMILES notation for 1-phenylethylhydrazine?
The canonical SMILES for 1-phenylethylhydrazine is CC(NN)c1ccccc1.
What is the InChIKey of 1-phenylethylhydrazine?
The InChIKey is HHRZAEJMHSGZNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2/c1-7(10-9)8-5-3-2-4-6-8/h2-7,10H,9H2,1H3.
What are the key properties of 1-phenylethylhydrazine?
1-phenylethylhydrazine has a molecular weight of 136.20 g/mol, XLogP of 1.21, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylethylhydrazine is sourced from PubChem (CID 6179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).