C23H30O4 — CID 618393
1-(10,13-dimethyl-3,12-dioxo-2,6,7,8,14,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-17-yl)ethyl acetate (PubChem CID 618393) has the molecular formula C23H30O4 and a molecular weight of 370.49 g/mol. Its IUPAC name is 1-(10,13-dimethyl-3,12-dioxo-2,6,7,8,14,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-17-yl)ethyl acetate.
| Compound Name | 1-(10,13-dimethyl-3,12-dioxo-2,6,7,8,14,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-17-yl)ethyl acetate |
|---|---|
| PubChem CID | 618393 |
| Molecular Formula | C23H30O4 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | 1-(10,13-dimethyl-3,12-dioxo-2,6,7,8,14,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-17-yl)ethyl acetate |
| SMILES | CC(=O)OC(C)C1CCC2C3CCC4=CC(=O)CCC4(C)C3=CC(=O)C12C |
| InChI | InChI=1S/C23H30O4/c1-13(27-14(2)24)18-7-8-19-17-6-5-15-11-16(25)9-10-22(15,3)20(17)12-21(26)23(18,19)4/h11-13,17-19H,5-10H2,1-4H3 |
| InChIKey | YOEFKLWNEMLSQM-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |