C12H14N4O3 — CID 618723
2-[(4,6-dimethoxy-1,3,5-triazin-2-yl)amino]-4-methylphenol (PubChem CID 618723) has the molecular formula C12H14N4O3 and a molecular weight of 262.27 g/mol. Its IUPAC name is 2-[(4,6-dimethoxy-1,3,5-triazin-2-yl)amino]-4-methylphenol.
| Compound Name | 2-[(4,6-dimethoxy-1,3,5-triazin-2-yl)amino]-4-methylphenol |
|---|---|
| PubChem CID | 618723 |
| Molecular Formula | C12H14N4O3 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 2-[(4,6-dimethoxy-1,3,5-triazin-2-yl)amino]-4-methylphenol |
| SMILES | COc1nc(Nc2cc(C)ccc2O)nc(OC)n1 |
| InChI | InChI=1S/C12H14N4O3/c1-7-4-5-9(17)8(6-7)13-10-14-11(18-2)16-12(15-10)19-3/h4-6,17H,1-3H3,(H,13,14,15,16) |
| InChIKey | CCPVDHDYLHMRLV-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 89.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|