C13H17N5O2 — CID 63758913
N-[2-(1-aminoethyl)phenyl]-4,6-dimethoxy-1,3,5-triazin-2-amine (PubChem CID 63758913) has the molecular formula C13H17N5O2 and a molecular weight of 275.31 g/mol. Its IUPAC name is N-[2-(1-aminoethyl)phenyl]-4,6-dimethoxy-1,3,5-triazin-2-amine.
| Compound Name | N-[2-(1-aminoethyl)phenyl]-4,6-dimethoxy-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 63758913 |
| Molecular Formula | C13H17N5O2 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | N-[2-(1-aminoethyl)phenyl]-4,6-dimethoxy-1,3,5-triazin-2-amine |
| SMILES | COc1nc(Nc2ccccc2C(C)N)nc(OC)n1 |
| InChI | InChI=1S/C13H17N5O2/c1-8(14)9-6-4-5-7-10(9)15-11-16-12(19-2)18-13(17-11)20-3/h4-8H,14H2,1-3H3,(H,15,16,17,18) |
| InChIKey | XLNBNPAOOMMPFH-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 95.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |