C32H29N3O3S2 — CID 6192472
(5Z)-5-[[3-[3-[(4-methylphenyl)methoxy]phenyl]-1-phenylpyrazol-4-yl]methylidene]-3-(oxolan-2-ylmethyl)-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 6192472) has the molecular formula C32H29N3O3S2 and a molecular weight of 567.74 g/mol. Its IUPAC name is (5Z)-5-[[3-[3-[(4-methylphenyl)methoxy]phenyl]-1-phenylpyrazol-4-yl]methylidene]-3-(oxolan-2-ylmethyl)-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[3-[3-[(4-methylphenyl)methoxy]phenyl]-1-phenylpyrazol-4-yl]methylidene]-3-(oxolan-2-ylmethyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 6192472 |
| Molecular Formula | C32H29N3O3S2 |
| Molecular Weight | 567.74 g/mol |
| Exact Mass | 567.17 |
| IUPAC Name | (5Z)-5-[[3-[3-[(4-methylphenyl)methoxy]phenyl]-1-phenylpyrazol-4-yl]methylidene]-3-(oxolan-2-ylmethyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | Cc1ccc(COc2cccc(-c3nn(-c4ccccc4)cc3/C=C3\SC(=S)N(CC4CCCO4)C3=O)c2)cc1 |
| InChI | InChI=1S/C32H29N3O3S2/c1-22-12-14-23(15-13-22)21-38-27-10-5-7-24(17-27)30-25(19-35(33-30)26-8-3-2-4-9-26)18-29-31(36)34(32(39)40-29)20-28-11-6-16-37-28/h2-5,7-10,12-15,17-19,28H,6,11,16,20-21H2,1H3/b29-18- |
| InChIKey | DOLKDGCUOPXXQR-MIXAMLLLSA-N |
| XLogP | 6.81 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.74 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|