C13H22N2O2S — CID 62003055
N-(2,4-dimethylphenyl)-2-(ethylamino)-N-methylethanesulfonamide (PubChem CID 62003055) has the molecular formula C13H22N2O2S and a molecular weight of 270.40 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-2-(ethylamino)-N-methylethanesulfonamide.
| Compound Name | N-(2,4-dimethylphenyl)-2-(ethylamino)-N-methylethanesulfonamide |
|---|---|
| PubChem CID | 62003055 |
| Molecular Formula | C13H22N2O2S |
| Molecular Weight | 270.40 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | N-(2,4-dimethylphenyl)-2-(ethylamino)-N-methylethanesulfonamide |
| SMILES | CCNCCS(=O)(=O)N(C)c1ccc(C)cc1C |
| InChI | InChI=1S/C13H22N2O2S/c1-5-14-8-9-18(16,17)15(4)13-7-6-11(2)10-12(13)3/h6-7,10,14H,5,8-9H2,1-4H3 |
| InChIKey | YDZCEQRGNAEGNI-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.40 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|