C14H22N2O4S — CID 62007153
ethyl 2-[N-methyl-2-(propan-2-ylsulfamoyl)anilino]acetate (PubChem CID 62007153) has the molecular formula C14H22N2O4S and a molecular weight of 314.41 g/mol. Its IUPAC name is ethyl 2-[N-methyl-2-(propan-2-ylsulfamoyl)anilino]acetate.
| Compound Name | ethyl 2-[N-methyl-2-(propan-2-ylsulfamoyl)anilino]acetate |
|---|---|
| PubChem CID | 62007153 |
| Molecular Formula | C14H22N2O4S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | ethyl 2-[N-methyl-2-(propan-2-ylsulfamoyl)anilino]acetate |
| SMILES | CCOC(=O)CN(C)c1ccccc1S(=O)(=O)NC(C)C |
| InChI | InChI=1S/C14H22N2O4S/c1-5-20-14(17)10-16(4)12-8-6-7-9-13(12)21(18,19)15-11(2)3/h6-9,11,15H,5,10H2,1-4H3 |
| InChIKey | ZJTOUULYXPLQJZ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |