C8H15N3O2 — CID 62014255
2-[1,2,4-oxadiazol-3-ylmethyl(propyl)amino]ethanol (PubChem CID 62014255) has the molecular formula C8H15N3O2 and a molecular weight of 185.23 g/mol. Its IUPAC name is 2-[1,2,4-oxadiazol-3-ylmethyl(propyl)amino]ethanol.
| Compound Name | 2-[1,2,4-oxadiazol-3-ylmethyl(propyl)amino]ethanol |
|---|---|
| PubChem CID | 62014255 |
| Molecular Formula | C8H15N3O2 |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | 2-[1,2,4-oxadiazol-3-ylmethyl(propyl)amino]ethanol |
| SMILES | CCCN(CCO)Cc1ncon1 |
| InChI | InChI=1S/C8H15N3O2/c1-2-3-11(4-5-12)6-8-9-7-13-10-8/h7,12H,2-6H2,1H3 |
| InChIKey | OBKNZPURBXHNCX-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |