C15H22ClFN2O2 — CID 62015284
N-(2-chloro-4-fluorophenyl)-2-[2-hydroxyethyl(pentan-3-yl)amino]acetamide (PubChem CID 62015284) has the molecular formula C15H22ClFN2O2 and a molecular weight of 316.80 g/mol. Its IUPAC name is N-(2-chloro-4-fluorophenyl)-2-[2-hydroxyethyl(pentan-3-yl)amino]acetamide.
| Compound Name | N-(2-chloro-4-fluorophenyl)-2-[2-hydroxyethyl(pentan-3-yl)amino]acetamide |
|---|---|
| PubChem CID | 62015284 |
| Molecular Formula | C15H22ClFN2O2 |
| Molecular Weight | 316.80 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | N-(2-chloro-4-fluorophenyl)-2-[2-hydroxyethyl(pentan-3-yl)amino]acetamide |
| SMILES | CCC(CC)N(CCO)CC(=O)Nc1ccc(F)cc1Cl |
| InChI | InChI=1S/C15H22ClFN2O2/c1-3-12(4-2)19(7-8-20)10-15(21)18-14-6-5-11(17)9-13(14)16/h5-6,9,12,20H,3-4,7-8,10H2,1-2H3,(H,18,21) |
| InChIKey | WUZHOKRUDSROMX-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.80 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |