C9H7ClN4O3S — CID 62024187
1-(5-chlorothiophen-2-yl)-2-(3-nitro-1,2,4-triazol-1-yl)propan-1-one (PubChem CID 62024187) has the molecular formula C9H7ClN4O3S and a molecular weight of 286.70 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)-2-(3-nitro-1,2,4-triazol-1-yl)propan-1-one.
| Compound Name | 1-(5-chlorothiophen-2-yl)-2-(3-nitro-1,2,4-triazol-1-yl)propan-1-one |
|---|---|
| PubChem CID | 62024187 |
| Molecular Formula | C9H7ClN4O3S |
| Molecular Weight | 286.70 g/mol |
| Exact Mass | 285.99 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)-2-(3-nitro-1,2,4-triazol-1-yl)propan-1-one |
| SMILES | CC(C(=O)c1ccc(Cl)s1)n1cnc([N+](=O)[O-])n1 |
| InChI | InChI=1S/C9H7ClN4O3S/c1-5(8(15)6-2-3-7(10)18-6)13-4-11-9(12-13)14(16)17/h2-5H,1H3 |
| InChIKey | GNUHMZVAGAVBMR-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 90.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.70 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|