C13H19NO3S2 — CID 62034269
2-[2-methylpropyl-[2-(thiophen-2-ylmethylsulfanyl)acetyl]amino]acetic acid (PubChem CID 62034269) has the molecular formula C13H19NO3S2 and a molecular weight of 301.43 g/mol. Its IUPAC name is 2-[2-methylpropyl-[2-(thiophen-2-ylmethylsulfanyl)acetyl]amino]acetic acid.
| Compound Name | 2-[2-methylpropyl-[2-(thiophen-2-ylmethylsulfanyl)acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 62034269 |
| Molecular Formula | C13H19NO3S2 |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | 2-[2-methylpropyl-[2-(thiophen-2-ylmethylsulfanyl)acetyl]amino]acetic acid |
| SMILES | CC(C)CN(CC(=O)O)C(=O)CSCc1cccs1 |
| InChI | InChI=1S/C13H19NO3S2/c1-10(2)6-14(7-13(16)17)12(15)9-18-8-11-4-3-5-19-11/h3-5,10H,6-9H2,1-2H3,(H,16,17) |
| InChIKey | QVMMXCXFQIVBRJ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |