C13H16N6O — CID 62040678
4-N-[3-(5-methyl-1H-pyrazol-4-yl)propyl]-2,1,3-benzoxadiazole-4,7-diamine (PubChem CID 62040678) has the molecular formula C13H16N6O and a molecular weight of 272.31 g/mol. Its IUPAC name is 4-N-[3-(5-methyl-1H-pyrazol-4-yl)propyl]-2,1,3-benzoxadiazole-4,7-diamine.
| Compound Name | 4-N-[3-(5-methyl-1H-pyrazol-4-yl)propyl]-2,1,3-benzoxadiazole-4,7-diamine |
|---|---|
| PubChem CID | 62040678 |
| Molecular Formula | C13H16N6O |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | 4-N-[3-(5-methyl-1H-pyrazol-4-yl)propyl]-2,1,3-benzoxadiazole-4,7-diamine |
| SMILES | Cc1[nH]ncc1CCCNc1ccc(N)c2nonc12 |
| InChI | InChI=1S/C13H16N6O/c1-8-9(7-16-17-8)3-2-6-15-11-5-4-10(14)12-13(11)19-20-18-12/h4-5,7,15H,2-3,6,14H2,1H3,(H,16,17) |
| InChIKey | KJMBTRSRMUIVRD-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 105.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|